C15H23FN2O2 — CID 114832096
methyl 2-[2-(dimethylamino)ethylamino]-3-(2-fluorophenyl)-2-methylpropanoate (PubChem CID 114832096) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 2-[2-(dimethylamino)ethylamino]-3-(2-fluorophenyl)-2-methylpropanoate.
| Compound Name | methyl 2-[2-(dimethylamino)ethylamino]-3-(2-fluorophenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 114832096 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl 2-[2-(dimethylamino)ethylamino]-3-(2-fluorophenyl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(Cc1ccccc1F)NCCN(C)C |
| InChI | InChI=1S/C15H23FN2O2/c1-15(14(19)20-4,17-9-10-18(2)3)11-12-7-5-6-8-13(12)16/h5-8,17H,9-11H2,1-4H3 |
| InChIKey | CKWPLNXPQWZXMQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |