C15H20Cl2FNO2 — CID 63523954
ethyl 2-(butan-2-ylamino)-2-(2,4-dichloro-5-fluorophenyl)propanoate (PubChem CID 63523954) has the molecular formula C15H20Cl2FNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is ethyl 2-(butan-2-ylamino)-2-(2,4-dichloro-5-fluorophenyl)propanoate.
| Compound Name | ethyl 2-(butan-2-ylamino)-2-(2,4-dichloro-5-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 63523954 |
| Molecular Formula | C15H20Cl2FNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl 2-(butan-2-ylamino)-2-(2,4-dichloro-5-fluorophenyl)propanoate |
| SMILES | CCOC(=O)C(C)(NC(C)CC)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2FNO2/c1-5-9(3)19-15(4,14(20)21-6-2)10-7-13(18)12(17)8-11(10)16/h7-9,19H,5-6H2,1-4H3 |
| InChIKey | RJRLVEMGEJRFMY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|