C15H23ClFNO — CID 103041084
2-[(3-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylbutan-1-amine (PubChem CID 103041084) has the molecular formula C15H23ClFNO and a molecular weight of 287.81 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylbutan-1-amine.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 103041084 |
| Molecular Formula | C15H23ClFNO |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylbutan-1-amine |
| SMILES | CCC(C)(CNCCOC)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClFNO/c1-4-15(2,11-18-7-8-19-3)10-12-5-6-14(17)13(16)9-12/h5-6,9,18H,4,7-8,10-11H2,1-3H3 |
| InChIKey | OYNBDDLECZOXDQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|