C16H25ClFN — CID 103041060
2-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-N-propan-2-ylpentan-1-amine (PubChem CID 103041060) has the molecular formula C16H25ClFN and a molecular weight of 285.83 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-N-propan-2-ylpentan-1-amine.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 103041060 |
| Molecular Formula | C16H25ClFN |
| Molecular Weight | 285.83 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-N-propan-2-ylpentan-1-amine |
| SMILES | CCCC(C)(CNC(C)C)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H25ClFN/c1-5-8-16(4,11-19-12(2)3)10-13-6-7-15(18)14(17)9-13/h6-7,9,12,19H,5,8,10-11H2,1-4H3 |
| InChIKey | HYYFPMKNLMMOBR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |