C16H25F2NO — CID 82929889
2-[(3,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylpentan-1-amine (PubChem CID 82929889) has the molecular formula C16H25F2NO and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylpentan-1-amine.
| Compound Name | 2-[(3,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 82929889 |
| Molecular Formula | C16H25F2NO |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-2-methylpentan-1-amine |
| SMILES | CCCC(C)(CNCCOC)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H25F2NO/c1-4-7-16(2,12-19-8-9-20-3)11-13-5-6-14(17)15(18)10-13/h5-6,10,19H,4,7-9,11-12H2,1-3H3 |
| InChIKey | PNXFZPBWFTYYFP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|