C13H18ClFO — CID 114852559
1-(4-chloro-2-fluorophenyl)-2,3,3-trimethylbutan-2-ol (PubChem CID 114852559) has the molecular formula C13H18ClFO and a molecular weight of 244.74 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2,3,3-trimethylbutan-2-ol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2,3,3-trimethylbutan-2-ol |
|---|---|
| PubChem CID | 114852559 |
| Molecular Formula | C13H18ClFO |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2,3,3-trimethylbutan-2-ol |
| SMILES | CC(C)(C)C(C)(O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H18ClFO/c1-12(2,3)13(4,16)8-9-5-6-10(14)7-11(9)15/h5-7,16H,8H2,1-4H3 |
| InChIKey | YUTFHROUUQCJKC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |