C9H9F2N5S — CID 107052228
3,5-difluoro-4-[(2-methyltetrazol-5-yl)methylsulfanyl]aniline (PubChem CID 107052228) has the molecular formula C9H9F2N5S and a molecular weight of 257.27 g/mol. Its IUPAC name is 3,5-difluoro-4-[(2-methyltetrazol-5-yl)methylsulfanyl]aniline.
| Compound Name | 3,5-difluoro-4-[(2-methyltetrazol-5-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 107052228 |
| Molecular Formula | C9H9F2N5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3,5-difluoro-4-[(2-methyltetrazol-5-yl)methylsulfanyl]aniline |
| SMILES | Cn1nnc(CSc2c(F)cc(N)cc2F)n1 |
| InChI | InChI=1S/C9H9F2N5S/c1-16-14-8(13-15-16)4-17-9-6(10)2-5(12)3-7(9)11/h2-3H,4,12H2,1H3 |
| InChIKey | XEWCHBDHPFEAJV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|