About (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate
(1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate (PubChem CID 82877153) has the molecular formula C12H12FN3O2
and a molecular weight of 249.25 g/mol. Its IUPAC name is (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate.
Molecular Properties
| Compound Name | (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate |
| PubChem CID | 82877153 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate |
| SMILES | Cn1ccc(COC(=O)c2cc(N)cc(F)c2)n1 |
| InChI | InChI=1S/C12H12FN3O2/c1-16-3-2-11(15-16)7-18-12(17)8-4-9(13)6-10(14)5-8/h2-6H,7,14H2,1H3 |
| InChIKey | BHRMFYRSUWMXFM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate?
The IUPAC name of (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate (CID 82877153) is (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate.
What is the SMILES notation for (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate?
The canonical SMILES for (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate is Cn1ccc(COC(=O)c2cc(N)cc(F)c2)n1.
What is the InChIKey of (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate?
The InChIKey is BHRMFYRSUWMXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O2/c1-16-3-2-11(15-16)7-18-12(17)8-4-9(13)6-10(14)5-8/h2-6H,7,14H2,1H3.
What are the key properties of (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate?
(1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate has a molecular weight of 249.25 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-3-yl)methyl 3-amino-5-fluorobenzoate is sourced from PubChem (CID 82877153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).