C14H12BrFN2O2 — CID 79709480
(3-bromo-5-fluorophenyl)methyl 3,5-diaminobenzoate (PubChem CID 79709480) has the molecular formula C14H12BrFN2O2 and a molecular weight of 339.16 g/mol. Its IUPAC name is (3-bromo-5-fluorophenyl)methyl 3,5-diaminobenzoate.
| Compound Name | (3-bromo-5-fluorophenyl)methyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 79709480 |
| Molecular Formula | C14H12BrFN2O2 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | (3-bromo-5-fluorophenyl)methyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCc2cc(F)cc(Br)c2)c1 |
| InChI | InChI=1S/C14H12BrFN2O2/c15-10-1-8(2-11(16)5-10)7-20-14(19)9-3-12(17)6-13(18)4-9/h1-6H,7,17-18H2 |
| InChIKey | HFHSSSMLMUGMAP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|