C14H9BrF3NO2 — CID 106269697
(3-bromo-2,6-difluorophenyl)methyl 3-amino-5-fluorobenzoate (PubChem CID 106269697) has the molecular formula C14H9BrF3NO2 and a molecular weight of 360.13 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)methyl 3-amino-5-fluorobenzoate.
| Compound Name | (3-bromo-2,6-difluorophenyl)methyl 3-amino-5-fluorobenzoate |
|---|---|
| PubChem CID | 106269697 |
| Molecular Formula | C14H9BrF3NO2 |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)methyl 3-amino-5-fluorobenzoate |
| SMILES | Nc1cc(F)cc(C(=O)OCc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C14H9BrF3NO2/c15-11-1-2-12(17)10(13(11)18)6-21-14(20)7-3-8(16)5-9(19)4-7/h1-5H,6,19H2 |
| InChIKey | RMMWLVKIOSEEIU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|