C13H7Br2F2NO — CID 106944116
(3-amino-5-bromophenyl)-(3-bromo-2,6-difluorophenyl)methanone (PubChem CID 106944116) has the molecular formula C13H7Br2F2NO and a molecular weight of 391.01 g/mol. Its IUPAC name is (3-amino-5-bromophenyl)-(3-bromo-2,6-difluorophenyl)methanone.
| Compound Name | (3-amino-5-bromophenyl)-(3-bromo-2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 106944116 |
| Molecular Formula | C13H7Br2F2NO |
| Molecular Weight | 391.01 g/mol |
| Exact Mass | 388.89 |
| IUPAC Name | (3-amino-5-bromophenyl)-(3-bromo-2,6-difluorophenyl)methanone |
| SMILES | Nc1cc(Br)cc(C(=O)c2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C13H7Br2F2NO/c14-7-3-6(4-8(18)5-7)13(19)11-10(16)2-1-9(15)12(11)17/h1-5H,18H2 |
| InChIKey | RPCUTZVRDLPIJK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.01 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|