C13H16N4O2 — CID 82876097
(1-methylpyrazol-3-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 82876097) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (1-methylpyrazol-3-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
| Compound Name | (1-methylpyrazol-3-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 82876097 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1-methylpyrazol-3-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | Cn1ccc(COC(=O)c2cc(N)cn2C2CC2)n1 |
| InChI | InChI=1S/C13H16N4O2/c1-16-5-4-10(15-16)8-19-13(18)12-6-9(14)7-17(12)11-2-3-11/h4-7,11H,2-3,8,14H2,1H3 |
| InChIKey | NWGWDABWPSMXIF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |