C16H15N3O2 — CID 61314737
(3-cyanophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 61314737) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
| Compound Name | (3-cyanophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61314737 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (3-cyanophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | N#Cc1cccc(COC(=O)c2cc(N)cn2C2CC2)c1 |
| InChI | InChI=1S/C16H15N3O2/c17-8-11-2-1-3-12(6-11)10-21-16(20)15-7-13(18)9-19(15)14-4-5-14/h1-3,6-7,9,14H,4-5,10,18H2 |
| InChIKey | XKHCTKGIFBYBCX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |