C18H15NO2S2 — CID 7744250
(3-cyanophenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744250) has the molecular formula C18H15NO2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | (3-cyanophenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744250 |
| Molecular Formula | C18H15NO2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (3-cyanophenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | N#Cc1cccc(COC(=O)c2ccc(C3SCCS3)cc2)c1 |
| InChI | InChI=1S/C18H15NO2S2/c19-11-13-2-1-3-14(10-13)12-21-17(20)15-4-6-16(7-5-15)18-22-8-9-23-18/h1-7,10,18H,8-9,12H2 |
| InChIKey | USJXXJGUWDQPQK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |