C13H13ClN2O2S — CID 61314370
(5-chlorothiophen-2-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 61314370) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
| Compound Name | (5-chlorothiophen-2-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61314370 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | Nc1cc(C(=O)OCc2ccc(Cl)s2)n(C2CC2)c1 |
| InChI | InChI=1S/C13H13ClN2O2S/c14-12-4-3-10(19-12)7-18-13(17)11-5-8(15)6-16(11)9-1-2-9/h3-6,9H,1-2,7,15H2 |
| InChIKey | CUYXOZBTVSNINY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |