About 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate
3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 65180401) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| PubChem CID | 65180401 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | CCOCCCOC(=O)c1cc(N)cn1C1CC1 |
| InChI | InChI=1S/C13H20N2O3/c1-2-17-6-3-7-18-13(16)12-8-10(14)9-15(12)11-4-5-11/h8-9,11H,2-7,14H2,1H3 |
| InChIKey | WMLPOHYWHYHUJI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
The IUPAC name of 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (CID 65180401) is 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
What is the SMILES notation for 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
The canonical SMILES for 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate is CCOCCCOC(=O)c1cc(N)cn1C1CC1.
What is the InChIKey of 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
The InChIKey is WMLPOHYWHYHUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-2-17-6-3-7-18-13(16)12-8-10(14)9-15(12)11-4-5-11/h8-9,11H,2-7,14H2,1H3.
What are the key properties of 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate has a molecular weight of 252.31 g/mol, XLogP of 1.99, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxypropyl 4-amino-1-cyclopropylpyrrole-2-carboxylate is sourced from PubChem (CID 65180401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).