C11H16N2O3 — CID 65366812
ethoxymethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 65366812) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is ethoxymethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
| Compound Name | ethoxymethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 65366812 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | ethoxymethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | CCOCOC(=O)c1cc(N)cn1C1CC1 |
| InChI | InChI=1S/C11H16N2O3/c1-2-15-7-16-11(14)10-5-8(12)6-13(10)9-3-4-9/h5-6,9H,2-4,7,12H2,1H3 |
| InChIKey | XBCITMOPGLAIQP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|