About 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate
2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 79228438) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| PubChem CID | 79228438 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | Nc1cc(C(=O)OCCSc2ccccc2)n(C2CC2)c1 |
| InChI | InChI=1S/C16H18N2O2S/c17-12-10-15(18(11-12)13-6-7-13)16(19)20-8-9-21-14-4-2-1-3-5-14/h1-5,10-11,13H,6-9,17H2 |
| InChIKey | RTAXTZIOQWWTOC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
The IUPAC name of 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (CID 79228438) is 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
What is the SMILES notation for 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
The canonical SMILES for 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate is Nc1cc(C(=O)OCCSc2ccccc2)n(C2CC2)c1.
What is the InChIKey of 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
The InChIKey is RTAXTZIOQWWTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c17-12-10-15(18(11-12)13-6-7-13)16(19)20-8-9-21-14-4-2-1-3-5-14/h1-5,10-11,13H,6-9,17H2.
What are the key properties of 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate?
2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate has a molecular weight of 302.40 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylethyl 4-amino-1-cyclopropylpyrrole-2-carboxylate is sourced from PubChem (CID 79228438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).