C15H15ClN2O2 — CID 61308313
(2-chlorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 61308313) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
| Compound Name | (2-chlorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61308313 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (2-chlorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | Nc1cc(C(=O)OCc2ccccc2Cl)n(C2CC2)c1 |
| InChI | InChI=1S/C15H15ClN2O2/c16-13-4-2-1-3-10(13)9-20-15(19)14-7-11(17)8-18(14)12-5-6-12/h1-4,7-8,12H,5-6,9,17H2 |
| InChIKey | MUHVDKYZJKHFOQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |