C15H14BrFN2O2 — CID 61316831
(5-bromo-2-fluorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate (PubChem CID 61316831) has the molecular formula C15H14BrFN2O2 and a molecular weight of 353.19 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate.
| Compound Name | (5-bromo-2-fluorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61316831 |
| Molecular Formula | C15H14BrFN2O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (5-bromo-2-fluorophenyl)methyl 4-amino-1-cyclopropylpyrrole-2-carboxylate |
| SMILES | Nc1cc(C(=O)OCc2cc(Br)ccc2F)n(C2CC2)c1 |
| InChI | InChI=1S/C15H14BrFN2O2/c16-10-1-4-13(17)9(5-10)8-21-15(20)14-6-11(18)7-19(14)12-2-3-12/h1,4-7,12H,2-3,8,18H2 |
| InChIKey | COSQIBUFFCBFHR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |