About (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate
(5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate (PubChem CID 61321831) has the molecular formula C14H10BrClFNO2
and a molecular weight of 358.59 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate.
Molecular Properties
| Compound Name | (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate |
| PubChem CID | 61321831 |
| Molecular Formula | C14H10BrClFNO2 |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate |
| SMILES | Nc1ccc(Cl)c(C(=O)OCc2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C14H10BrClFNO2/c15-9-1-4-13(17)8(5-9)7-20-14(19)11-6-10(18)2-3-12(11)16/h1-6H,7,18H2 |
| InChIKey | FQNGYNNZIOPLAH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate?
The IUPAC name of (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate (CID 61321831) is (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate.
What is the SMILES notation for (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate?
The canonical SMILES for (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate is Nc1ccc(Cl)c(C(=O)OCc2cc(Br)ccc2F)c1.
What is the InChIKey of (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate?
The InChIKey is FQNGYNNZIOPLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrClFNO2/c15-9-1-4-13(17)8(5-9)7-20-14(19)11-6-10(18)2-3-12(11)16/h1-6H,7,18H2.
What are the key properties of (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate?
(5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate has a molecular weight of 358.59 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2-fluorophenyl)methyl 5-amino-2-chlorobenzoate is sourced from PubChem (CID 61321831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).