C13H10F3NS — CID 114930393
4-[(2,6-difluorophenyl)methylsulfanyl]-3-fluoroaniline (PubChem CID 114930393) has the molecular formula C13H10F3NS and a molecular weight of 269.29 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methylsulfanyl]-3-fluoroaniline.
| Compound Name | 4-[(2,6-difluorophenyl)methylsulfanyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 114930393 |
| Molecular Formula | C13H10F3NS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methylsulfanyl]-3-fluoroaniline |
| SMILES | Nc1ccc(SCc2c(F)cccc2F)c(F)c1 |
| InChI | InChI=1S/C13H10F3NS/c14-10-2-1-3-11(15)9(10)7-18-13-5-4-8(17)6-12(13)16/h1-6H,7,17H2 |
| InChIKey | KCSGRIOYFFPFPS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|