About 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline
2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 61169264) has the molecular formula C10H8ClIN2S
and a molecular weight of 350.61 g/mol. Its IUPAC name is 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline |
| PubChem CID | 61169264 |
| Molecular Formula | C10H8ClIN2S |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Clc1cc(I)ccc1NCc1cscn1 |
| InChI | InChI=1S/C10H8ClIN2S/c11-9-3-7(12)1-2-10(9)13-4-8-5-15-6-14-8/h1-3,5-6,13H,4H2 |
| InChIKey | DKKUZSKHVQYQRM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline?
The IUPAC name of 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline (CID 61169264) is 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline.
What is the SMILES notation for 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline?
The canonical SMILES for 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline is Clc1cc(I)ccc1NCc1cscn1.
What is the InChIKey of 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline?
The InChIKey is DKKUZSKHVQYQRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClIN2S/c11-9-3-7(12)1-2-10(9)13-4-8-5-15-6-14-8/h1-3,5-6,13H,4H2.
What are the key properties of 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline?
2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline has a molecular weight of 350.61 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-iodo-N-(1,3-thiazol-4-ylmethyl)aniline is sourced from PubChem (CID 61169264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).