C11H9ClN4S — CID 171644777
5-chloro-N-(1,3-thiazol-4-ylmethyl)-1H-indazol-6-amine (PubChem CID 171644777) has the molecular formula C11H9ClN4S and a molecular weight of 264.74 g/mol. Its IUPAC name is 5-chloro-N-(1,3-thiazol-4-ylmethyl)-1H-indazol-6-amine.
| Compound Name | 5-chloro-N-(1,3-thiazol-4-ylmethyl)-1H-indazol-6-amine |
|---|---|
| PubChem CID | 171644777 |
| Molecular Formula | C11H9ClN4S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 5-chloro-N-(1,3-thiazol-4-ylmethyl)-1H-indazol-6-amine |
| SMILES | Clc1cc2cn[nH]c2cc1NCc1cscn1 |
| InChI | InChI=1S/C11H9ClN4S/c12-9-1-7-3-15-16-10(7)2-11(9)13-4-8-5-17-6-14-8/h1-3,5-6,13H,4H2,(H,15,16) |
| InChIKey | UOLQRXLEQAAOHK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |