C10H7ClF2N2S — CID 83081963
2-chloro-4,6-difluoro-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 83081963) has the molecular formula C10H7ClF2N2S and a molecular weight of 260.70 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 83081963 |
| Molecular Formula | C10H7ClF2N2S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(NCc2cscn2)c(Cl)c1 |
| InChI | InChI=1S/C10H7ClF2N2S/c11-8-1-6(12)2-9(13)10(8)14-3-7-4-16-5-15-7/h1-2,4-5,14H,3H2 |
| InChIKey | ATEIZCYNFLXNNA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |