C11H13N3OS — CID 80735351
5-methoxy-3-N-(1,3-thiazol-4-ylmethyl)benzene-1,3-diamine (PubChem CID 80735351) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-methoxy-3-N-(1,3-thiazol-4-ylmethyl)benzene-1,3-diamine.
| Compound Name | 5-methoxy-3-N-(1,3-thiazol-4-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80735351 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-methoxy-3-N-(1,3-thiazol-4-ylmethyl)benzene-1,3-diamine |
| SMILES | COc1cc(N)cc(NCc2cscn2)c1 |
| InChI | InChI=1S/C11H13N3OS/c1-15-11-3-8(12)2-9(4-11)13-5-10-6-16-7-14-10/h2-4,6-7,13H,5,12H2,1H3 |
| InChIKey | STPCWDOQMMYYIN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|