C13H15ClN2OS — CID 61170045
3-chloro-4-propan-2-yloxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 61170045) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is 3-chloro-4-propan-2-yloxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 3-chloro-4-propan-2-yloxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 61170045 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-chloro-4-propan-2-yloxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | CC(C)Oc1ccc(NCc2cscn2)cc1Cl |
| InChI | InChI=1S/C13H15ClN2OS/c1-9(2)17-13-4-3-10(5-12(13)14)15-6-11-7-18-8-16-11/h3-5,7-9,15H,6H2,1-2H3 |
| InChIKey | BSPVMQMSJFHBEB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|