C16H18ClNO3 — CID 43727146
4-[(3-chloro-4-propan-2-yloxyanilino)methyl]benzene-1,3-diol (PubChem CID 43727146) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 4-[(3-chloro-4-propan-2-yloxyanilino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(3-chloro-4-propan-2-yloxyanilino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43727146 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[(3-chloro-4-propan-2-yloxyanilino)methyl]benzene-1,3-diol |
| SMILES | CC(C)Oc1ccc(NCc2ccc(O)cc2O)cc1Cl |
| InChI | InChI=1S/C16H18ClNO3/c1-10(2)21-16-6-4-12(7-14(16)17)18-9-11-3-5-13(19)8-15(11)20/h3-8,10,18-20H,9H2,1-2H3 |
| InChIKey | QWCGFEXZYQUUHA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|