C12H18ClN3S — CID 115606209
2-butan-2-yl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride (PubChem CID 115606209) has the molecular formula C12H18ClN3S and a molecular weight of 271.82 g/mol. Its IUPAC name is 2-butan-2-yl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride.
| Compound Name | 2-butan-2-yl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 115606209 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-butan-2-yl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride |
| SMILES | CCC(C)n1nccc1NCc1ccsc1.Cl |
| InChI | InChI=1S/C12H17N3S.ClH/c1-3-10(2)15-12(4-6-14-15)13-8-11-5-7-16-9-11;/h4-7,9-10,13H,3,8H2,1-2H3;1H |
| InChIKey | KGKCNSDQCDPWLQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |