C9H12N4S — CID 131131813
2-ethyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine (PubChem CID 131131813) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-ethyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine.
| Compound Name | 2-ethyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 131131813 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-ethyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine |
| SMILES | CCn1nccc1NCc1nccs1 |
| InChI | InChI=1S/C9H12N4S/c1-2-13-8(3-4-12-13)11-7-9-10-5-6-14-9/h3-6,11H,2,7H2,1H3 |
| InChIKey | NOMJQBALIZTMAU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |