About 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine
1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine (PubChem CID 66013608) has the molecular formula C10H15N5S
and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine |
| PubChem CID | 66013608 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine |
| SMILES | CCn1nc(C)c(N)c1NCc1nccs1 |
| InChI | InChI=1S/C10H15N5S/c1-3-15-10(9(11)7(2)14-15)13-6-8-12-4-5-16-8/h4-5,13H,3,6,11H2,1-2H3 |
| InChIKey | JRSMEGGIILOFPD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine?
The IUPAC name of 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine (CID 66013608) is 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine.
What is the SMILES notation for 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine?
The canonical SMILES for 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine is CCn1nc(C)c(N)c1NCc1nccs1.
What is the InChIKey of 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine?
The InChIKey is JRSMEGGIILOFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5S/c1-3-15-10(9(11)7(2)14-15)13-6-8-12-4-5-16-8/h4-5,13H,3,6,11H2,1-2H3.
What are the key properties of 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine?
1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine has a molecular weight of 237.33 g/mol, XLogP of 1.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-5-N-(1,3-thiazol-2-ylmethyl)pyrazole-4,5-diamine is sourced from PubChem (CID 66013608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).