C8H11N5S — CID 4727838
1-ethyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine (PubChem CID 4727838) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is 1-ethyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine.
| Compound Name | 1-ethyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 4727838 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-ethyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine |
| SMILES | CCn1nnnc1NCc1ccsc1 |
| InChI | InChI=1S/C8H11N5S/c1-2-13-8(10-11-12-13)9-5-7-3-4-14-6-7/h3-4,6H,2,5H2,1H3,(H,9,10,12) |
| InChIKey | KVLVXQFUTRQQMR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |