C14H18BrN5O2 — CID 4726994
N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-ethyltetrazol-5-amine (PubChem CID 4726994) has the molecular formula C14H18BrN5O2 and a molecular weight of 368.24 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-ethyltetrazol-5-amine.
| Compound Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-ethyltetrazol-5-amine |
|---|---|
| PubChem CID | 4726994 |
| Molecular Formula | C14H18BrN5O2 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-ethyltetrazol-5-amine |
| SMILES | C=CCOc1c(Br)cc(CNc2nnnn2CC)cc1OC |
| InChI | InChI=1S/C14H18BrN5O2/c1-4-6-22-13-11(15)7-10(8-12(13)21-3)9-16-14-17-18-19-20(14)5-2/h4,7-8H,1,5-6,9H2,2-3H3,(H,16,17,19) |
| InChIKey | VKBNTIQHELLSFT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|