C10H12ClN3O2 — CID 43563856
2-chloro-N-[methyl(pyridin-3-ylmethyl)carbamoyl]acetamide (PubChem CID 43563856) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is 2-chloro-N-[methyl(pyridin-3-ylmethyl)carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[methyl(pyridin-3-ylmethyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 43563856 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-chloro-N-[methyl(pyridin-3-ylmethyl)carbamoyl]acetamide |
| SMILES | CN(Cc1cccnc1)C(=O)NC(=O)CCl |
| InChI | InChI=1S/C10H12ClN3O2/c1-14(10(16)13-9(15)5-11)7-8-3-2-4-12-6-8/h2-4,6H,5,7H2,1H3,(H,13,15,16) |
| InChIKey | MWUSDVGSVOQIST-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|