C14H24N4O2 — CID 157252146
2-[(2-amino-1-pyridin-3-ylethyl)amino]ethyl N-butylcarbamate (PubChem CID 157252146) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[(2-amino-1-pyridin-3-ylethyl)amino]ethyl N-butylcarbamate.
| Compound Name | 2-[(2-amino-1-pyridin-3-ylethyl)amino]ethyl N-butylcarbamate |
|---|---|
| PubChem CID | 157252146 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-[(2-amino-1-pyridin-3-ylethyl)amino]ethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCCNC(CN)c1cccnc1 |
| InChI | InChI=1S/C14H24N4O2/c1-2-3-7-18-14(19)20-9-8-17-13(10-15)12-5-4-6-16-11-12/h4-6,11,13,17H,2-3,7-10,15H2,1H3,(H,18,19) |
| InChIKey | AWLSOEMQOSJOBI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|