C11H19N3 — CID 65383709
N-(2-methylpropyl)-1-pyridin-3-ylethane-1,2-diamine (PubChem CID 65383709) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(2-methylpropyl)-1-pyridin-3-ylethane-1,2-diamine.
| Compound Name | N-(2-methylpropyl)-1-pyridin-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 65383709 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-(2-methylpropyl)-1-pyridin-3-ylethane-1,2-diamine |
| SMILES | CC(C)CNC(CN)c1cccnc1 |
| InChI | InChI=1S/C11H19N3/c1-9(2)7-14-11(6-12)10-4-3-5-13-8-10/h3-5,8-9,11,14H,6-7,12H2,1-2H3 |
| InChIKey | SXLVEXGLAVRNFJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |