C9H15N3 — CID 116933165
2-methyl-1-pyridin-3-ylpropane-1,3-diamine (PubChem CID 116933165) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-methyl-1-pyridin-3-ylpropane-1,3-diamine.
| Compound Name | 2-methyl-1-pyridin-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116933165 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2-methyl-1-pyridin-3-ylpropane-1,3-diamine |
| SMILES | CC(CN)C(N)c1cccnc1 |
| InChI | InChI=1S/C9H15N3/c1-7(5-10)9(11)8-3-2-4-12-6-8/h2-4,6-7,9H,5,10-11H2,1H3 |
| InChIKey | LXNOISSIFQQCPM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |