C13H22N2O — CID 80523424
1-amino-4,5-dimethyl-2-pyridin-3-ylhexan-3-ol (PubChem CID 80523424) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-amino-4,5-dimethyl-2-pyridin-3-ylhexan-3-ol.
| Compound Name | 1-amino-4,5-dimethyl-2-pyridin-3-ylhexan-3-ol |
|---|---|
| PubChem CID | 80523424 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-amino-4,5-dimethyl-2-pyridin-3-ylhexan-3-ol |
| SMILES | CC(C)C(C)C(O)C(CN)c1cccnc1 |
| InChI | InChI=1S/C13H22N2O/c1-9(2)10(3)13(16)12(7-14)11-5-4-6-15-8-11/h4-6,8-10,12-13,16H,7,14H2,1-3H3 |
| InChIKey | MFEQOHPJIMSBEP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |