C14H15ClN2O — CID 80523261
3-amino-1-(2-chlorophenyl)-2-pyridin-3-ylpropan-1-ol (PubChem CID 80523261) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is 3-amino-1-(2-chlorophenyl)-2-pyridin-3-ylpropan-1-ol.
| Compound Name | 3-amino-1-(2-chlorophenyl)-2-pyridin-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 80523261 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-amino-1-(2-chlorophenyl)-2-pyridin-3-ylpropan-1-ol |
| SMILES | NCC(c1cccnc1)C(O)c1ccccc1Cl |
| InChI | InChI=1S/C14H15ClN2O/c15-13-6-2-1-5-11(13)14(18)12(8-16)10-4-3-7-17-9-10/h1-7,9,12,14,18H,8,16H2 |
| InChIKey | GSCTVDGQMASHGE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |