C14H14ClFN2O — CID 81262776
3-amino-1-(3-chloro-2-fluorophenyl)-2-pyridin-3-ylpropan-1-ol (PubChem CID 81262776) has the molecular formula C14H14ClFN2O and a molecular weight of 280.73 g/mol. Its IUPAC name is 3-amino-1-(3-chloro-2-fluorophenyl)-2-pyridin-3-ylpropan-1-ol.
| Compound Name | 3-amino-1-(3-chloro-2-fluorophenyl)-2-pyridin-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 81262776 |
| Molecular Formula | C14H14ClFN2O |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-amino-1-(3-chloro-2-fluorophenyl)-2-pyridin-3-ylpropan-1-ol |
| SMILES | NCC(c1cccnc1)C(O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C14H14ClFN2O/c15-12-5-1-4-10(13(12)16)14(19)11(7-17)9-3-2-6-18-8-9/h1-6,8,11,14,19H,7,17H2 |
| InChIKey | HKXFORDVRRLHQI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |