C12H21N3 — CID 83929792
2-(3-pyridin-3-ylbutan-2-yl)propane-1,3-diamine (PubChem CID 83929792) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(3-pyridin-3-ylbutan-2-yl)propane-1,3-diamine.
| Compound Name | 2-(3-pyridin-3-ylbutan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83929792 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-(3-pyridin-3-ylbutan-2-yl)propane-1,3-diamine |
| SMILES | CC(c1cccnc1)C(C)C(CN)CN |
| InChI | InChI=1S/C12H21N3/c1-9(10(2)12(6-13)7-14)11-4-3-5-15-8-11/h3-5,8-10,12H,6-7,13-14H2,1-2H3 |
| InChIKey | JDLFVVBXMJOMOX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |