C10H18N4 — CID 105259347
3-hydrazinyl-N,N-dimethyl-3-pyridin-3-ylpropan-1-amine (PubChem CID 105259347) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-hydrazinyl-N,N-dimethyl-3-pyridin-3-ylpropan-1-amine.
| Compound Name | 3-hydrazinyl-N,N-dimethyl-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 105259347 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 3-hydrazinyl-N,N-dimethyl-3-pyridin-3-ylpropan-1-amine |
| SMILES | CN(C)CCC(NN)c1cccnc1 |
| InChI | InChI=1S/C10H18N4/c1-14(2)7-5-10(13-11)9-4-3-6-12-8-9/h3-4,6,8,10,13H,5,7,11H2,1-2H3 |
| InChIKey | BLMHRQMLKGXCPM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|