C9H14N2S — CID 116831467
3-(methylamino)-3-pyridin-3-ylpropane-1-thiol (PubChem CID 116831467) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 3-(methylamino)-3-pyridin-3-ylpropane-1-thiol.
| Compound Name | 3-(methylamino)-3-pyridin-3-ylpropane-1-thiol |
|---|---|
| PubChem CID | 116831467 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-(methylamino)-3-pyridin-3-ylpropane-1-thiol |
| SMILES | CNC(CCS)c1cccnc1 |
| InChI | InChI=1S/C9H14N2S/c1-10-9(4-6-12)8-3-2-5-11-7-8/h2-3,5,7,9-10,12H,4,6H2,1H3 |
| InChIKey | KJOAIMBHOWKJTJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|