C9H17N5 — CID 105259139
3-hydrazinyl-N,N-dimethyl-3-pyrimidin-5-ylpropan-1-amine (PubChem CID 105259139) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-hydrazinyl-N,N-dimethyl-3-pyrimidin-5-ylpropan-1-amine.
| Compound Name | 3-hydrazinyl-N,N-dimethyl-3-pyrimidin-5-ylpropan-1-amine |
|---|---|
| PubChem CID | 105259139 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 3-hydrazinyl-N,N-dimethyl-3-pyrimidin-5-ylpropan-1-amine |
| SMILES | CN(C)CCC(NN)c1cncnc1 |
| InChI | InChI=1S/C9H17N5/c1-14(2)4-3-9(13-10)8-5-11-7-12-6-8/h5-7,9,13H,3-4,10H2,1-2H3 |
| InChIKey | HFGAXDZUMBWHEM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|