C9H17N3O — CID 105259357
3-(furan-3-yl)-3-hydrazinyl-N,N-dimethylpropan-1-amine (PubChem CID 105259357) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(furan-3-yl)-3-hydrazinyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(furan-3-yl)-3-hydrazinyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 105259357 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 3-(furan-3-yl)-3-hydrazinyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC(NN)c1ccoc1 |
| InChI | InChI=1S/C9H17N3O/c1-12(2)5-3-9(11-10)8-4-6-13-7-8/h4,6-7,9,11H,3,5,10H2,1-2H3 |
| InChIKey | ZMKYVQGTXIPLBG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|