C10H18N2OS — CID 105227274
[2-butan-2-ylsulfanyl-1-(furan-3-yl)ethyl]hydrazine (PubChem CID 105227274) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is [2-butan-2-ylsulfanyl-1-(furan-3-yl)ethyl]hydrazine.
| Compound Name | [2-butan-2-ylsulfanyl-1-(furan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105227274 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | [2-butan-2-ylsulfanyl-1-(furan-3-yl)ethyl]hydrazine |
| SMILES | CCC(C)SCC(NN)c1ccoc1 |
| InChI | InChI=1S/C10H18N2OS/c1-3-8(2)14-7-10(12-11)9-4-5-13-6-9/h4-6,8,10,12H,3,7,11H2,1-2H3 |
| InChIKey | NIVRNWSWMOPNQC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|