C13H22N2 — CID 104581333
N-(2-methylpropyl)-1-pyridin-3-ylbutan-1-amine (PubChem CID 104581333) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-(2-methylpropyl)-1-pyridin-3-ylbutan-1-amine.
| Compound Name | N-(2-methylpropyl)-1-pyridin-3-ylbutan-1-amine |
|---|---|
| PubChem CID | 104581333 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-(2-methylpropyl)-1-pyridin-3-ylbutan-1-amine |
| SMILES | CCCC(NCC(C)C)c1cccnc1 |
| InChI | InChI=1S/C13H22N2/c1-4-6-13(15-9-11(2)3)12-7-5-8-14-10-12/h5,7-8,10-11,13,15H,4,6,9H2,1-3H3 |
| InChIKey | PCNQESORYIVONZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |