C14H24N2 — CID 115799813
2-methyl-N-propyl-1-pyridin-3-ylpentan-1-amine (PubChem CID 115799813) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-methyl-N-propyl-1-pyridin-3-ylpentan-1-amine.
| Compound Name | 2-methyl-N-propyl-1-pyridin-3-ylpentan-1-amine |
|---|---|
| PubChem CID | 115799813 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2-methyl-N-propyl-1-pyridin-3-ylpentan-1-amine |
| SMILES | CCCNC(c1cccnc1)C(C)CCC |
| InChI | InChI=1S/C14H24N2/c1-4-7-12(3)14(16-9-5-2)13-8-6-10-15-11-13/h6,8,10-12,14,16H,4-5,7,9H2,1-3H3 |
| InChIKey | MRYFVGOMVWSTKA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |