C16H28N2 — CID 114013829
1-(3-ethyl-2-pyridinyl)-2-methyl-N-propylpentan-1-amine (PubChem CID 114013829) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(3-ethyl-2-pyridinyl)-2-methyl-N-propylpentan-1-amine.
| Compound Name | 1-(3-ethyl-2-pyridinyl)-2-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 114013829 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-(3-ethyl-2-pyridinyl)-2-methyl-N-propylpentan-1-amine |
| SMILES | CCCNC(c1ncccc1CC)C(C)CCC |
| InChI | InChI=1S/C16H28N2/c1-5-9-13(4)15(17-11-6-2)16-14(7-3)10-8-12-18-16/h8,10,12-13,15,17H,5-7,9,11H2,1-4H3 |
| InChIKey | RWDOXQORUSQIBI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |