C15H22N2 — CID 82741096
1-(3-ethyl-2-pyridinyl)-N-propylpent-4-yn-1-amine (PubChem CID 82741096) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 1-(3-ethyl-2-pyridinyl)-N-propylpent-4-yn-1-amine.
| Compound Name | 1-(3-ethyl-2-pyridinyl)-N-propylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 82741096 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(3-ethyl-2-pyridinyl)-N-propylpent-4-yn-1-amine |
| SMILES | C#CCCC(NCCC)c1ncccc1CC |
| InChI | InChI=1S/C15H22N2/c1-4-7-10-14(16-11-5-2)15-13(6-3)9-8-12-17-15/h1,8-9,12,14,16H,5-7,10-11H2,2-3H3 |
| InChIKey | DJUPMUGNAIWSTP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|